Products 2246855-32-1

CAS 2246855-32-1 is the registry number for (4-(Bicyclo[2.2.1]heptan-2-yloxy)phenyl)boronic acid, 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

[4-(2-bicyclo[2.2.1]heptanyloxy)phenyl]boronic acid (CAS 2246855-32-1) is a chemical compound with the molecular formula C13H17BO3 and a molecular weight of 232.09 g/mol. IUPAC name: [4-(2-bicyclo[2.2.1]heptanyloxy)phenyl]boronic acid. InChIKey: GZSRSMUZEPZOGD-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17BO3
Molecular weight232.09 g/mol
IUPAC name[4-(2-bicyclo[2.2.1]heptanyloxy)phenyl]boronic acid
InChIKeyGZSRSMUZEPZOGD-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)OC2CC3CCC2C3)(O)O

Computed by PubChem (NCBI)