CAS 380151-85-9 appears in our catalog under these names: 2–Formylphenylboronic acid pinacol ester, 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde, >97.0%(GC)(T), 2-Formylphenylboronic acid pinacol ester, 97%, 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde 97%, 2-FORMYLPHENYLBORONIC ACID PINACOL ESTER. Offered by: GLPBio, TCI, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 25g, 1g, 5g, 10g, 500g.
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 380151-85-9) is a chemical compound with the molecular formula C13H17BO3 and a molecular weight of 232.09 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: SLJMPQLPRHIAOM-UHFFFAOYSA-N.
| Molecular formula | C13H17BO3 |
|---|---|
| Molecular weight | 232.09 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | SLJMPQLPRHIAOM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2C=O |
Computed by PubChem (NCBI)