CAS 380151-86-0 appears in our catalog under these names: 3-Formylphenylboronic acid, pinacol ester, 97%, 3–Formylphenylboronic acid, pinacol ester(contains varying amounts of Anhydride), 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde/ 95+%, 3-Formylbenzeneboronic acid, pinacol ester, 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde, >98.0%(GC). Offered by: Combi-blocks, GLPBio, Chemat, Biosynth, TCI. Available pack sizes: 10g, 100g, 25g, 5g, 1g, 500g, 250mg.
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 380151-86-0) is a chemical compound with the molecular formula C13H17BO3 and a molecular weight of 232.09 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: IFYMOLFMYIDYEN-UHFFFAOYSA-N.
| Molecular formula | C13H17BO3 |
|---|---|
| Molecular weight | 232.09 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | IFYMOLFMYIDYEN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C=O |
Computed by PubChem (NCBI)