cas: 74483-45-7 — see every product listed under this CAS number, including other names
(4-(Chloromethyl)phenyl)(trifluoromethyl)sulfane 97% (CAS 74483-45-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A816169-5g |
| cas | 74483-45-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 320.31 Pln | |
| Ambeed | 25g | 748.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A816169 |
1-(chloromethyl)-4-(trifluoromethylsulfanyl)benzene (CAS 74483-45-7) is a chemical compound with the molecular formula C8H6ClF3S and a molecular weight of 226.65 g/mol. IUPAC name: 1-(chloromethyl)-4-(trifluoromethylsulfanyl)benzene. InChIKey: BEWDYNRVCARDOP-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3S |
|---|---|
| Molecular weight | 226.65 g/mol |
| IUPAC name | 1-(chloromethyl)-4-(trifluoromethylsulfanyl)benzene |
| InChIKey | BEWDYNRVCARDOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCl)SC(F)(F)F |
Computed by PubChem (NCBI)