CAS 1428234-60-9 appears in our catalog under these names: 4-Chloro-2-methylthio-1-(trifluoromethyl)benzene, 95%, (5-Chloro-2-(trifluoromethyl)phenyl)(methyl)sulfane, 97%, 4-Chloro-2-methylthio-1-(trifluoromethyl)benzene. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
4-chloro-2-methylsulfanyl-1-(trifluoromethyl)benzene (CAS 1428234-60-9) is a chemical compound with the molecular formula C8H6ClF3S and a molecular weight of 226.65 g/mol. IUPAC name: 4-chloro-2-methylsulfanyl-1-(trifluoromethyl)benzene. InChIKey: FHCOODCYNHAVJZ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3S |
|---|---|
| Molecular weight | 226.65 g/mol |
| IUPAC name | 4-chloro-2-methylsulfanyl-1-(trifluoromethyl)benzene |
| InChIKey | FHCOODCYNHAVJZ-UHFFFAOYSA-N |
| SMILES | CSC1=C(C=CC(=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)