CAS 74483-45-7 appears in our catalog under these names: 4-(Trifluoromethylthio)benzyl chloride, 95%, (4-(Chloromethyl)phenyl)(trifluoromethyl)sulfane 97%, 4-(Trifluoromethylthio)benzylchloride, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 25g, 1g, 5g.
1-(chloromethyl)-4-(trifluoromethylsulfanyl)benzene (CAS 74483-45-7) is a chemical compound with the molecular formula C8H6ClF3S and a molecular weight of 226.65 g/mol. IUPAC name: 1-(chloromethyl)-4-(trifluoromethylsulfanyl)benzene. InChIKey: BEWDYNRVCARDOP-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3S |
|---|---|
| Molecular weight | 226.65 g/mol |
| IUPAC name | 1-(chloromethyl)-4-(trifluoromethylsulfanyl)benzene |
| InChIKey | BEWDYNRVCARDOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCl)SC(F)(F)F |
Computed by PubChem (NCBI)