cas: 762262-07-7 — see every product listed under this CAS number, including other names
(4-(Cyclohexylcarbamoyl)phenyl)boronic acid, 97%, 97% (CAS 762262-07-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G3L6-100mg |
| cas | 762262-07-7 |
| size | 100mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[4-(cyclohexylcarbamoyl)phenyl]boronic acid (CAS 762262-07-7) is a chemical compound with the molecular formula C13H18BNO3 and a molecular weight of 247.10 g/mol. IUPAC name: [4-(cyclohexylcarbamoyl)phenyl]boronic acid. InChIKey: OBTMUEHMFSJFFR-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO3 |
|---|---|
| Molecular weight | 247.10 g/mol |
| IUPAC name | [4-(cyclohexylcarbamoyl)phenyl]boronic acid |
| InChIKey | OBTMUEHMFSJFFR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2CCCCC2)(O)O |
Computed by PubChem (NCBI)