CAS 480424-94-0 appears in our catalog under these names: 4-Formamidophenylboronic acid, pinacol ester, 97%, N-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)formamide 95+%, 4-Formamidophenylboronic acid, pinacol ester, 95+%, 95+%, n-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)formamide, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]formamide (CAS 480424-94-0) is a chemical compound with the molecular formula C13H18BNO3 and a molecular weight of 247.10 g/mol. IUPAC name: N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]formamide. InChIKey: CDYFHMUSLGPPMI-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO3 |
|---|---|
| Molecular weight | 247.10 g/mol |
| IUPAC name | N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]formamide |
| InChIKey | CDYFHMUSLGPPMI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC=O |
Computed by PubChem (NCBI)