CAS 1103862-13-0 appears in our catalog under these names: 3-Acetylpyridine-5-boronic acid, pinacol ester, 96%, 3-Acetylpyridine-5-boronic Acid Pinacol Ester, 1-(5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)ethanone, 98%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 250mg, 1g, 2,5g, 10g.
1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]ethanone (CAS 1103862-13-0) is a chemical compound with the molecular formula C13H18BNO3 and a molecular weight of 247.10 g/mol. IUPAC name: 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]ethanone. InChIKey: PUYOTRMLWYCWSJ-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO3 |
|---|---|
| Molecular weight | 247.10 g/mol |
| IUPAC name | 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]ethanone |
| InChIKey | PUYOTRMLWYCWSJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)C(=O)C |
Computed by PubChem (NCBI)