cas: 850568-15-9 — see every product listed under this CAS number, including other names
(4-(Cyclopentylcarbamoyl)phenyl)boronic acid, 98% (CAS 850568-15-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A837070-1g |
| cas | 850568-15-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 369.46 Pln | |
| Fluorochem | 1g | 393.63 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
[4-(cyclopentylcarbamoyl)phenyl]boronic acid (CAS 850568-15-9) is a chemical compound with the molecular formula C12H16BNO3 and a molecular weight of 233.07 g/mol. IUPAC name: [4-(cyclopentylcarbamoyl)phenyl]boronic acid. InChIKey: VMJFATWKBZYOFO-UHFFFAOYSA-N.
| Molecular formula | C12H16BNO3 |
|---|---|
| Molecular weight | 233.07 g/mol |
| IUPAC name | [4-(cyclopentylcarbamoyl)phenyl]boronic acid |
| InChIKey | VMJFATWKBZYOFO-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2CCCC2)(O)O |
Computed by PubChem (NCBI)