cas: 850568-15-9 — see every product listed under this CAS number, including other names
Boronic acid, B-[4-[(cyclopentylamino)carbonyl]phenyl]-, 98%, 98% (CAS 850568-15-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115PC5-100mg |
| cas | 850568-15-9 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 126.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[4-(cyclopentylcarbamoyl)phenyl]boronic acid (CAS 850568-15-9) is a chemical compound with the molecular formula C12H16BNO3 and a molecular weight of 233.07 g/mol. IUPAC name: [4-(cyclopentylcarbamoyl)phenyl]boronic acid. InChIKey: VMJFATWKBZYOFO-UHFFFAOYSA-N.
| Molecular formula | C12H16BNO3 |
|---|---|
| Molecular weight | 233.07 g/mol |
| IUPAC name | [4-(cyclopentylcarbamoyl)phenyl]boronic acid |
| InChIKey | VMJFATWKBZYOFO-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2CCCC2)(O)O |
Computed by PubChem (NCBI)