cas: 2377605-97-3 — see every product listed under this CAS number, including other names
(4-(Cyclopropylmethoxy)-2,6-difluorophenyl)boronic acid, 98%, 98% (CAS 2377605-97-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JVNB-1g |
| cas | 2377605-97-3 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 712.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[4-(cyclopropylmethoxy)-2,6-difluorophenyl]boronic acid (CAS 2377605-97-3) is a chemical compound with the molecular formula C10H11BF2O3 and a molecular weight of 228.00 g/mol. IUPAC name: [4-(cyclopropylmethoxy)-2,6-difluorophenyl]boronic acid. InChIKey: PDBCTMNIDSXOAC-UHFFFAOYSA-N.
| Molecular formula | C10H11BF2O3 |
|---|---|
| Molecular weight | 228.00 g/mol |
| IUPAC name | [4-(cyclopropylmethoxy)-2,6-difluorophenyl]boronic acid |
| InChIKey | PDBCTMNIDSXOAC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)OCC2CC2)F)(O)O |
Computed by PubChem (NCBI)