CAS 2377605-97-3 appears in our catalog under these names: [4-(Cyclopropylmethoxy)-2,6-difluorophenyl]boronic acid, 97%, (4-(Cyclopropylmethoxy)-2,6-difluorophenyl)boronic acid 98%, (4-(Cyclopropylmethoxy)-2,6-difluorophenyl)boronic acid, 98%, 98%, [4-(Cyclopropylmethoxy)-2,6-difluorophenyl]boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg.
[4-(cyclopropylmethoxy)-2,6-difluorophenyl]boronic acid (CAS 2377605-97-3) is a chemical compound with the molecular formula C10H11BF2O3 and a molecular weight of 228.00 g/mol. IUPAC name: [4-(cyclopropylmethoxy)-2,6-difluorophenyl]boronic acid. InChIKey: PDBCTMNIDSXOAC-UHFFFAOYSA-N.
| Molecular formula | C10H11BF2O3 |
|---|---|
| Molecular weight | 228.00 g/mol |
| IUPAC name | [4-(cyclopropylmethoxy)-2,6-difluorophenyl]boronic acid |
| InChIKey | PDBCTMNIDSXOAC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)OCC2CC2)F)(O)O |
Computed by PubChem (NCBI)