CAS 2096333-16-1 appears in our catalog under these names: 5-(Cyclopropylmethoxy)-2,4-difluorophenylboronic acid, 98%, (5-(Cyclopropylmethoxy)-2,4-difluorophenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
[5-(cyclopropylmethoxy)-2,4-difluorophenyl]boronic acid (CAS 2096333-16-1) is a chemical compound with the molecular formula C10H11BF2O3 and a molecular weight of 228.00 g/mol. IUPAC name: [5-(cyclopropylmethoxy)-2,4-difluorophenyl]boronic acid. InChIKey: XABLTWFJOUWSRX-UHFFFAOYSA-N.
| Molecular formula | C10H11BF2O3 |
|---|---|
| Molecular weight | 228.00 g/mol |
| IUPAC name | [5-(cyclopropylmethoxy)-2,4-difluorophenyl]boronic acid |
| InChIKey | XABLTWFJOUWSRX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)F)OCC2CC2)(O)O |
Computed by PubChem (NCBI)