cas: 874289-30-2 — see every product listed under this CAS number, including other names
(4-(Dimethylcarbamoyl)-2-fluorophenyl)boronic acid, 96% (CAS 874289-30-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219692-250MG |
| cas | 874289-30-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 315.53 Pln | |
| Fluorochem | 1g | 1008.00 Pln | |
| Fluorochem | 5g | 3507.12 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
[4-(dimethylcarbamoyl)-2-fluorophenyl]boronic acid (CAS 874289-30-2) is a chemical compound with the molecular formula C9H11BFNO3 and a molecular weight of 211.00 g/mol. IUPAC name: [4-(dimethylcarbamoyl)-2-fluorophenyl]boronic acid. InChIKey: IOTCMPCBVDPZTB-UHFFFAOYSA-N.
| Molecular formula | C9H11BFNO3 |
|---|---|
| Molecular weight | 211.00 g/mol |
| IUPAC name | [4-(dimethylcarbamoyl)-2-fluorophenyl]boronic acid |
| InChIKey | IOTCMPCBVDPZTB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)N(C)C)F)(O)O |
Computed by PubChem (NCBI)