cas: 874289-29-9 — see every product listed under this CAS number, including other names
(4-(Ethylcarbamoyl)-2-fluorophenyl)boronic acid, 95+% (CAS 874289-29-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A387284-10g |
| cas | 874289-29-9 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 19704.16 Pln | |
| AmBeed | 5g | 11579.68 Pln | |
| AmBeed | 25g | 38661.28 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
[4-(ethylcarbamoyl)-2-fluorophenyl]boronic acid (CAS 874289-29-9) is a chemical compound with the molecular formula C9H11BFNO3 and a molecular weight of 211.00 g/mol. IUPAC name: [4-(ethylcarbamoyl)-2-fluorophenyl]boronic acid. InChIKey: RVPOYQNEOOWSAW-UHFFFAOYSA-N.
| Molecular formula | C9H11BFNO3 |
|---|---|
| Molecular weight | 211.00 g/mol |
| IUPAC name | [4-(ethylcarbamoyl)-2-fluorophenyl]boronic acid |
| InChIKey | RVPOYQNEOOWSAW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)NCC)F)(O)O |
Computed by PubChem (NCBI)