cas: 397843-67-3 — see every product listed under this CAS number, including other names
(4-(Isopropylcarbamoyl)phenyl)boronic acid, 98%, 98% (CAS 397843-67-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1188CZ-100mg |
| cas | 397843-67-3 |
| size | 100mg |
| availability | 13.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 443.60 Pln | |
| Chemat | 10g | 707.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[4-(propan-2-ylcarbamoyl)phenyl]boronic acid (CAS 397843-67-3) is a chemical compound with the molecular formula C10H14BNO3 and a molecular weight of 207.04 g/mol. IUPAC name: [4-(propan-2-ylcarbamoyl)phenyl]boronic acid. InChIKey: GBCSEYKTZAKRMT-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO3 |
|---|---|
| Molecular weight | 207.04 g/mol |
| IUPAC name | [4-(propan-2-ylcarbamoyl)phenyl]boronic acid |
| InChIKey | GBCSEYKTZAKRMT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC(C)C)(O)O |
Computed by PubChem (NCBI)