cas: 397843-67-3 — see every product listed under this CAS number, including other names
(4-(Isopropylcarbamoyl)phenyl)boronic acid, 98% (CAS 397843-67-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219648-1G |
| cas | 397843-67-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 575.86 Pln | |
| Fluorochem | 25g | 2507.47 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
[4-(propan-2-ylcarbamoyl)phenyl]boronic acid (CAS 397843-67-3) is a chemical compound with the molecular formula C10H14BNO3 and a molecular weight of 207.04 g/mol. IUPAC name: [4-(propan-2-ylcarbamoyl)phenyl]boronic acid. InChIKey: GBCSEYKTZAKRMT-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO3 |
|---|---|
| Molecular weight | 207.04 g/mol |
| IUPAC name | [4-(propan-2-ylcarbamoyl)phenyl]boronic acid |
| InChIKey | GBCSEYKTZAKRMT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC(C)C)(O)O |
Computed by PubChem (NCBI)