CAS 186498-02-2 appears in our catalog under these names: 4-Morpholinophenylboronic acid, 97%, May contain varying amounts of anhydride , (4-Morpholinophenyl)boronic acid, 98%, 98%, 4-Morpholinophenylboronic acid (contains varying amounts of anhydride), 98%, (4-Morpholinophenyl)boronic acid, 98%. Offered by: Thermo Scientific, Chemat, Fluorochem, Ambeed. Available pack sizes: 250MG, 1g, 5g, 10g, 25g, 50g, 100g, 250g.
(4-morpholin-4-ylphenyl)boronic acid (CAS 186498-02-2) is a chemical compound with the molecular formula C10H14BNO3 and a molecular weight of 207.04 g/mol. IUPAC name: (4-morpholin-4-ylphenyl)boronic acid. InChIKey: WHDIUBHAKZDSJL-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO3 |
|---|---|
| Molecular weight | 207.04 g/mol |
| IUPAC name | (4-morpholin-4-ylphenyl)boronic acid |
| InChIKey | WHDIUBHAKZDSJL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N2CCOCC2)(O)O |
Computed by PubChem (NCBI)