cas: 877383-11-4 — see every product listed under this CAS number, including other names
(4-(Methylthio)-3-(trifluoromethyl)phenyl)boronic acid, 98+% (CAS 877383-11-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A134669-10g |
| cas | 877383-11-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 23089.36 Pln | |
| AmBeed | 25g | 45262.42 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
[4-methylsulfanyl-3-(trifluoromethyl)phenyl]boronic acid (CAS 877383-11-4) is a chemical compound with the molecular formula C8H8BF3O2S and a molecular weight of 236.02 g/mol. IUPAC name: [4-methylsulfanyl-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: ZGVHSZHWKMOCEZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O2S |
|---|---|
| Molecular weight | 236.02 g/mol |
| IUPAC name | [4-methylsulfanyl-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | ZGVHSZHWKMOCEZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)SC)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)