Products 877383-11-4
CAS 877383-11-4 appears in our catalog under these names: 4-Methylthio-3-(trifluoromethyl)phenylboronic acid, 4-Methylthio-3-(trifluoromethyl)phenylboronic acid, 95%, (4-(Methylthio)-3-(trifluoromethyl)phenyl)boronic acid, 98+%, (4-(Methylthio)-3-(trifluoromethyl)phenyl)boronic acid, ≥95%, ≥95%. Offered by: Fluorochem, Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
[4-methylsulfanyl-3-(trifluoromethyl)phenyl]boronic acid (CAS 877383-11-4) is a chemical compound with the molecular formula C8H8BF3O2S and a molecular weight of 236.02 g/mol. IUPAC name: [4-methylsulfanyl-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: ZGVHSZHWKMOCEZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O2S |
|---|---|
| Molecular weight | 236.02 g/mol |
| IUPAC name | [4-methylsulfanyl-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | ZGVHSZHWKMOCEZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)SC)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)