CAS 957120-83-1 appears in our catalog under these names: 3-(Methylthio)-5-(trifluoromethyl)phenylboronic acid, 98%, (3-(Methylthio)-5-(trifluoromethyl)phenyl)boronic acid, 98%, 3-(Methylthio)-5-(trifluoromethyl)phenylboronic acid, ≥95%, ≥95%, (3-(Methylthio)-5-(trifluoromethyl)phenyl)boronic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
[3-methylsulfanyl-5-(trifluoromethyl)phenyl]boronic acid (CAS 957120-83-1) is a chemical compound with the molecular formula C8H8BF3O2S and a molecular weight of 236.02 g/mol. IUPAC name: [3-methylsulfanyl-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: XIGZIOYWOLFBMQ-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O2S |
|---|---|
| Molecular weight | 236.02 g/mol |
| IUPAC name | [3-methylsulfanyl-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | XIGZIOYWOLFBMQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)SC)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)