cas: 913835-54-8 — see every product listed under this CAS number, including other names
(4-(N-(4-Methoxybenzyl)-N-methylsulfamoyl)phenyl)boronic acid 98% (CAS 913835-54-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A170603-1g |
| cas | 913835-54-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 698.56 Pln | |
| Ambeed | 25g | 1955.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A170603 |
[4-[(4-methoxyphenyl)methyl-methylsulfamoyl]phenyl]boronic acid (CAS 913835-54-8) is a chemical compound with the molecular formula C15H18BNO5S and a molecular weight of 335.2 g/mol. IUPAC name: [4-[(4-methoxyphenyl)methyl-methylsulfamoyl]phenyl]boronic acid. InChIKey: ZBCCMISCUYAJDA-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO5S |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | [4-[(4-methoxyphenyl)methyl-methylsulfamoyl]phenyl]boronic acid |
| InChIKey | ZBCCMISCUYAJDA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)N(C)CC2=CC=C(C=C2)OC)(O)O |
Computed by PubChem (NCBI)