CAS 913835-54-8 appears in our catalog under these names: 4-(N-Methyl-N-(4-methoxybenzyl)sulfamoyl)phenylboronic acid, 98%, (4-(N-(4-Methoxybenzyl)-N-methylsulfamoyl)phenyl)boronic acid 98%, 4-(N-Methyl-N-(4-methoxybenzyl)sulfamoyl)phenylboronic acid, 98%, 98%, (4-(N-(4-Methoxybenzyl)-N-methylsulfamoyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g.
[4-[(4-methoxyphenyl)methyl-methylsulfamoyl]phenyl]boronic acid (CAS 913835-54-8) is a chemical compound with the molecular formula C15H18BNO5S and a molecular weight of 335.2 g/mol. IUPAC name: [4-[(4-methoxyphenyl)methyl-methylsulfamoyl]phenyl]boronic acid. InChIKey: ZBCCMISCUYAJDA-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO5S |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | [4-[(4-methoxyphenyl)methyl-methylsulfamoyl]phenyl]boronic acid |
| InChIKey | ZBCCMISCUYAJDA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)N(C)CC2=CC=C(C=C2)OC)(O)O |
Computed by PubChem (NCBI)