Products 1218790-60-3

CAS 1218790-60-3 is the registry number for 2-(N-(4-Methoxybenzyl)-N-methylsulfamoyl)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g.

Structural formula: {0} (CAS {1})

[2-[(4-methoxyphenyl)methyl-methylsulfamoyl]phenyl]boronic acid (CAS 1218790-60-3) is a chemical compound with the molecular formula C15H18BNO5S and a molecular weight of 335.2 g/mol. IUPAC name: [2-[(4-methoxyphenyl)methyl-methylsulfamoyl]phenyl]boronic acid. InChIKey: JMOGLIMEOYXBIL-UHFFFAOYSA-N.

Identity
Molecular formulaC15H18BNO5S
Molecular weight335.2 g/mol
IUPAC name[2-[(4-methoxyphenyl)methyl-methylsulfamoyl]phenyl]boronic acid
InChIKeyJMOGLIMEOYXBIL-UHFFFAOYSA-N
SMILESB(C1=CC=CC=C1S(=O)(=O)N(C)CC2=CC=C(C=C2)OC)(O)O

Computed by PubChem (NCBI)