cas: 226396-31-2 — see every product listed under this CAS number, including other names
(4-(N-Methylsulfamoyl)phenyl)boronic acid, 97% (CAS 226396-31-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210895-250MG |
| cas | 226396-31-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 315.53 Pln | |
| Fluorochem | 5g | 955.93 Pln | |
| Fluorochem | 10g | 1861.86 Pln | |
| Fluorochem | 25g | 4579.66 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
[4-(methylsulfamoyl)phenyl]boronic acid (CAS 226396-31-2) is a chemical compound with the molecular formula C7H10BNO4S and a molecular weight of 215.04 g/mol. IUPAC name: [4-(methylsulfamoyl)phenyl]boronic acid. InChIKey: DOQOQZHSIBBHMY-UHFFFAOYSA-N.
| Molecular formula | C7H10BNO4S |
|---|---|
| Molecular weight | 215.04 g/mol |
| IUPAC name | [4-(methylsulfamoyl)phenyl]boronic acid |
| InChIKey | DOQOQZHSIBBHMY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NC)(O)O |
Computed by PubChem (NCBI)