cas: 226396-31-2 — see every product listed under this CAS number, including other names
(4-(N-Methylsulfamoyl)phenyl)boronic acid, 98%, 98% (CAS 226396-31-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BDT8-100mg |
| cas | 226396-31-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 875.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[4-(methylsulfamoyl)phenyl]boronic acid (CAS 226396-31-2) is a chemical compound with the molecular formula C7H10BNO4S and a molecular weight of 215.04 g/mol. IUPAC name: [4-(methylsulfamoyl)phenyl]boronic acid. InChIKey: DOQOQZHSIBBHMY-UHFFFAOYSA-N.
| Molecular formula | C7H10BNO4S |
|---|---|
| Molecular weight | 215.04 g/mol |
| IUPAC name | [4-(methylsulfamoyl)phenyl]boronic acid |
| InChIKey | DOQOQZHSIBBHMY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NC)(O)O |
Computed by PubChem (NCBI)