cas: 513246-99-6 — see every product listed under this CAS number, including other names
(4-(Piperazin-1-yl)phenyl)boronic acid, 95-<97% (CAS 513246-99-6) is a chemical reagent available from Chemat. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC17-95-97-2.5g |
| cas | 513246-99-6 |
| size | 2,5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 2,5g | 4116.86 Pln | |
| Hoffman Fine Chemicals | 5g | 6407.28 Pln | |
| Hoffman Fine Chemicals | 10g | 10260.80 Pln | |
| Hoffman Fine Chemicals | 25g | 20213.60 Pln | |
| Hoffman Fine Chemicals | 50g | 34147.52 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
(4-piperazin-1-ylphenyl)boronic acid (CAS 513246-99-6) is a chemical compound with the molecular formula C10H15BN2O2 and a molecular weight of 206.05 g/mol. IUPAC name: (4-piperazin-1-ylphenyl)boronic acid. InChIKey: WEKCEGUGFNLQIA-UHFFFAOYSA-N.
| Molecular formula | C10H15BN2O2 |
|---|---|
| Molecular weight | 206.05 g/mol |
| IUPAC name | (4-piperazin-1-ylphenyl)boronic acid |
| InChIKey | WEKCEGUGFNLQIA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N2CCNCC2)(O)O |
Computed by PubChem (NCBI)