CAS 1197172-06-7 is the registry number for 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazine, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazine (CAS 1197172-06-7) is a chemical compound with the molecular formula C10H15BN2O2 and a molecular weight of 206.05 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazine. InChIKey: JDVCSMNDMZIXCC-UHFFFAOYSA-N.
| Molecular formula | C10H15BN2O2 |
|---|---|
| Molecular weight | 206.05 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazine |
| InChIKey | JDVCSMNDMZIXCC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NN=CC=C2 |
Computed by PubChem (NCBI)