CAS 513246-99-6 appears in our catalog under these names: 4-(Piperazin-1-yl)phenylboronic acid, 95%, (4-(Piperazin-1-yl)phenyl)boronic acid, 95-<97%, (4-(Piperazin-1-yl)phenyl)boronic acid, ≥97-<99%, 4-(Piperazin-1-yl)phenylboronic acid, 98%, 98%, (4-(Piperazin-1-yl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 10g, 250mg, 2,5g, 25g, 50g.
(4-piperazin-1-ylphenyl)boronic acid (CAS 513246-99-6) is a chemical compound with the molecular formula C10H15BN2O2 and a molecular weight of 206.05 g/mol. IUPAC name: (4-piperazin-1-ylphenyl)boronic acid. InChIKey: WEKCEGUGFNLQIA-UHFFFAOYSA-N.
| Molecular formula | C10H15BN2O2 |
|---|---|
| Molecular weight | 206.05 g/mol |
| IUPAC name | (4-piperazin-1-ylphenyl)boronic acid |
| InChIKey | WEKCEGUGFNLQIA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N2CCNCC2)(O)O |
Computed by PubChem (NCBI)