cas: 98061-39-3 — see every product listed under this CAS number, including other names
(4-(Pyridin-2-yl)phenyl)methanol 98% (CAS 98061-39-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A411986-250mg |
| cas | 98061-39-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 392.62 Pln | |
| Ambeed | 1g | 804.25 Pln | |
| Ambeed | 5g | 2484.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A411986 |
(4-pyridin-2-ylphenyl)methanol (CAS 98061-39-3) is a chemical compound with the molecular formula C12H11NO and a molecular weight of 185.22 g/mol. IUPAC name: (4-pyridin-2-ylphenyl)methanol. InChIKey: BESAKUXOHCFPAA-UHFFFAOYSA-N.
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | (4-pyridin-2-ylphenyl)methanol |
| InChIKey | BESAKUXOHCFPAA-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=C(C=C2)CO |
Computed by PubChem (NCBI)