Products 146862-02-4

CAS 146862-02-4 appears in our catalog under these names: 4-(trans-4-Propylcyclohexyl)phenylboronic acid, 95%, (4-(trans-4-propylcyclohexyl)phenyl)boronic acid, 95%, (4-(trans-4-propylcyclohexyl)phenyl)boronic acid, 98%, 98%, 4-(trans-4-Propylcyclohexyl)phenylboronic Acid (contains varying amounts of Anhydride). Offered by: Fluorochem, Ambeed, Chemat, TCI. Available pack sizes: 5g, 25g, 100g, 500g, 10g, 1g.

Structural formula: {0} (CAS {1})

[4-(4-propylcyclohexyl)phenyl]boronic acid (CAS 146862-02-4) is a chemical compound with the molecular formula C15H23BO2 and a molecular weight of 246.15 g/mol. IUPAC name: [4-(4-propylcyclohexyl)phenyl]boronic acid. InChIKey: QTBUVZSHCNAPRT-UHFFFAOYSA-N.

Identity
Molecular formulaC15H23BO2
Molecular weight246.15 g/mol
IUPAC name[4-(4-propylcyclohexyl)phenyl]boronic acid
InChIKeyQTBUVZSHCNAPRT-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)C2CCC(CC2)CCC)(O)O

Computed by PubChem (NCBI)