cas: 77278-70-7 — see every product listed under this CAS number, including other names
(4-Boc-piperazin-1-yl)-acetamide, 98% (CAS 77278-70-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 250g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033869-250MG |
| cas | 77278-70-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 331.15 Pln | |
| Fluorochem | 5g | 706.02 Pln | |
| Fluorochem | 10g | 1127.75 Pln | |
| Fluorochem | 25g | 2200.28 Pln | |
| Fluorochem | 100g | 5745.91 Pln | |
| Fluorochem | 250g | 11691.73 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-(2-amino-2-oxoethyl)piperazine-1-carboxylate (CAS 77278-70-7) is a chemical compound with the molecular formula C11H21N3O3 and a molecular weight of 243.30 g/mol. IUPAC name: tert-butyl 4-(2-amino-2-oxoethyl)piperazine-1-carboxylate. InChIKey: AZWRCNSWXLELKF-UHFFFAOYSA-N.
| Molecular formula | C11H21N3O3 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | tert-butyl 4-(2-amino-2-oxoethyl)piperazine-1-carboxylate |
| InChIKey | AZWRCNSWXLELKF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)CC(=O)N |
Computed by PubChem (NCBI)