(4-Bromo-2-methoxyphenyl)boronic acid, 98%
cas: 889849-21-2 — see every product listed under this CAS number, including other names
(4-Bromo-2-methoxyphenyl)boronic acid, 98% (CAS 889849-21-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 500mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A356538-250mg |
| cas | 889849-21-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 1021.19 Pln | |
| Ambeed | 25g | 3457.56 Pln | |
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 500mg | 246.80 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 25g | 4168.40 Pln | |
| BLDpharm | 250mg | 219.95 Pln | |
| BLDpharm | 1g | 353.23 Pln | |
| BLDpharm | 5g | 1097.42 Pln | |
| BLDpharm | 25g | 3663.18 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(4-bromo-2-methoxyphenyl)boronic acid (CAS 889849-21-2) is a chemical compound with the molecular formula C7H8BBrO3 and a molecular weight of 230.85 g/mol. IUPAC name: (4-bromo-2-methoxyphenyl)boronic acid. InChIKey: VJWDDRPEDLXFLY-UHFFFAOYSA-N.
| Molecular formula | C7H8BBrO3 |
|---|---|
| Molecular weight | 230.85 g/mol |
| IUPAC name | (4-bromo-2-methoxyphenyl)boronic acid |
| InChIKey | VJWDDRPEDLXFLY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Br)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-Bromo-2-methoxyphenyl)boronic acid, (4-Bromo-2-methoxy-phenyl)boronic acid, 4-bromo-2-methoxyphenylboronicacid, 4-Bromo-2-methoxyphenyl)boronicacid, (4-Bromo-2-methoxyphenyl)boronicacid, 4-bromo2-methoxy-phenyl boronic acid, 4-Bromo-2-methoxyphenylboronic acid (contains varying amounts of Anhydride)