Products 849630-88-2
CAS 849630-88-2 is the registry number for (2-Bromo-3-methoxyphenyl)boronic acid, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
(2-bromo-3-methoxyphenyl)boronic acid (CAS 849630-88-2) is a chemical compound with the molecular formula C7H8BBrO3 and a molecular weight of 230.85 g/mol. IUPAC name: (2-bromo-3-methoxyphenyl)boronic acid. InChIKey: INLNROXDMBMFKA-UHFFFAOYSA-N.
| Molecular formula | C7H8BBrO3 |
|---|---|
| Molecular weight | 230.85 g/mol |
| IUPAC name | (2-bromo-3-methoxyphenyl)boronic acid |
| InChIKey | INLNROXDMBMFKA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)OC)Br)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2-bromo-3-methoxyphenyl)boronic acid, (2-bromo-3-methoxyphenyl)boronicacid, 2-Bromo-3-methoxybenzene boronic acid, 2-bromo-3-methoxyphenylboronic acid, INLNROXDMBMFKA-UHFFFAOYSA-N, (2-Bromo-3-mthoxyphnyl)boronic acid, B-(2-Bromo-3-methoxyphenyl)boronic acid, (2-bromanyl-3-methoxy-phenyl)boronic acid