cas: 95741-44-9 — see every product listed under this CAS number, including other names
(4-Bromo-3,5-dimethyl)phenyl benzyl ether (CAS 95741-44-9) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132NFU-200mg |
| cas | 95741-44-9 |
| size | 200mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 664.40 Pln | |
| Chemat | 1g | 1907.60 Pln | |
| Chemat | 5g | 7187.60 Pln |
| delivery time | 3 weeks |
|---|
2-bromo-1,3-dimethyl-5-phenylmethoxybenzene (CAS 95741-44-9) is a chemical compound with the molecular formula C15H15BrO and a molecular weight of 291.18 g/mol. IUPAC name: 2-bromo-1,3-dimethyl-5-phenylmethoxybenzene. InChIKey: LXPOYZVSGGMEMK-UHFFFAOYSA-N.
| Molecular formula | C15H15BrO |
|---|---|
| Molecular weight | 291.18 g/mol |
| IUPAC name | 2-bromo-1,3-dimethyl-5-phenylmethoxybenzene |
| InChIKey | LXPOYZVSGGMEMK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)