(4-Bromo-3-methoxyphenyl)boronic acid, 98%
cas: 1256345-59-1 — see every product listed under this CAS number, including other names
(4-Bromo-3-methoxyphenyl)boronic acid, 98% (CAS 1256345-59-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g, 50g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A148832-250mg |
| cas | 1256345-59-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 420.44 Pln | |
| Ambeed | 5g | 1482.88 Pln | |
| Ambeed | 25g | 6422.38 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1302.80 Pln | |
| Chemat | 25g | 2819.60 Pln | |
| Chemat | 50g | 4197.20 Pln | |
| BLDpharm | 100mg | 225.50 Pln | |
| BLDpharm | 250mg | 331.02 Pln | |
| BLDpharm | 1g | 447.64 Pln | |
| BLDpharm | 5g | 1591.69 Pln | |
| BLDpharm | 25g | 6917.59 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(4-bromo-3-methoxyphenyl)boronic acid (CAS 1256345-59-1) is a chemical compound with the molecular formula C7H8BBrO3 and a molecular weight of 230.85 g/mol. IUPAC name: (4-bromo-3-methoxyphenyl)boronic acid. InChIKey: LCRYXSUMYJSZDG-UHFFFAOYSA-N.
| Molecular formula | C7H8BBrO3 |
|---|---|
| Molecular weight | 230.85 g/mol |
| IUPAC name | (4-bromo-3-methoxyphenyl)boronic acid |
| InChIKey | LCRYXSUMYJSZDG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Br)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Bromo-3-Methoxyphenylboronic Acid, (4-Bromo-3-methoxyphenyl)boronic acid, Boronic acid, B-(4-bromo-3-methoxyphenyl)-, (4-Bromo-3-methoxyphenyl)boronicacid, LCRY, LCRYXSUMYJSZDG-UHFFFAOYSA-N, 4-bromo-3-methoxyphenyl boronic acid, (4-bromo-3-methoxy-phenyl)boronic acid, (4-Bromo-3-methoxyphenyl)boronic acid(contains varying amounts of Anhydride)