cas: 127580-92-1 — see every product listed under this CAS number, including other names
(4-Bromophenyl)(morpholino)methanone 97% (CAS 127580-92-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A404699-1g |
| cas | 127580-92-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 464.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A404699 |
(4-bromophenyl)-morpholin-4-ylmethanone (CAS 127580-92-1) is a chemical compound with the molecular formula C11H12BrNO2 and a molecular weight of 270.12 g/mol. IUPAC name: (4-bromophenyl)-morpholin-4-ylmethanone. InChIKey: FTAGZJAFWFNHAP-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO2 |
|---|---|
| Molecular weight | 270.12 g/mol |
| IUPAC name | (4-bromophenyl)-morpholin-4-ylmethanone |
| InChIKey | FTAGZJAFWFNHAP-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)