Products 939759-25-8
CAS 939759-25-8 appears in our catalog under these names: 3-Bromo-1-azetidinecarboxylic acid benzyl ester, 98%, Benzyl 3-bromoazetidine-1-carboxylate 95%, 3-Bromo-1-azetidinecarboxylic acid benzyl ester, 95%, 95%, Benzyl 3-bromoazetidine-1-carboxylate, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 500mg, 25g.
Benzyl 3-bromoazetidine-1-carboxylate (CAS 939759-25-8) is a chemical compound with the molecular formula C11H12BrNO2 and a molecular weight of 270.12 g/mol. IUPAC name: benzyl 3-bromoazetidine-1-carboxylate. InChIKey: SUBBMOROFINEHA-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO2 |
|---|---|
| Molecular weight | 270.12 g/mol |
| IUPAC name | benzyl 3-bromoazetidine-1-carboxylate |
| InChIKey | SUBBMOROFINEHA-UHFFFAOYSA-N |
| SMILES | C1C(CN1C(=O)OCC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)