CAS 1072944-35-4 is the registry number for N-Cyclopropyl 4-bromo-3-methoxybenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
4-bromo-N-cyclopropyl-3-methoxybenzamide (CAS 1072944-35-4) is a chemical compound with the molecular formula C11H12BrNO2 and a molecular weight of 270.12 g/mol. IUPAC name: 4-bromo-N-cyclopropyl-3-methoxybenzamide. InChIKey: ACZUAJCGIAVKNK-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO2 |
|---|---|
| Molecular weight | 270.12 g/mol |
| IUPAC name | 4-bromo-N-cyclopropyl-3-methoxybenzamide |
| InChIKey | ACZUAJCGIAVKNK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)NC2CC2)Br |
Computed by PubChem (NCBI)