cas: 1112209-32-1 — see every product listed under this CAS number, including other names
(4-CHLORO-3-FORMYLPHENYL)BORONIC ACID PINACOL ESTER, 97% (CAS 1112209-32-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F531419-100MG |
| cas | 1112209-32-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 721.64 Pln | |
| Fluorochem | 5g | 2533.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 1112209-32-1) is a chemical compound with the molecular formula C13H16BClO3 and a molecular weight of 266.53 g/mol. IUPAC name: 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: HRDRVQQDFZQKNR-UHFFFAOYSA-N.
| Molecular formula | C13H16BClO3 |
|---|---|
| Molecular weight | 266.53 g/mol |
| IUPAC name | 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | HRDRVQQDFZQKNR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)Cl)C=O |
Computed by PubChem (NCBI)