CAS 1352129-62-4 appears in our catalog under these names: 3-Chloro-2-formylphenylboronic acid pinacol ester, ≥95%, ≥95%, 3-Chloro-2-formylphenylboronic acid pinacol ester. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 1352129-62-4) is a chemical compound with the molecular formula C13H16BClO3 and a molecular weight of 266.53 g/mol. IUPAC name: 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: DVUIUQDBTIPHFS-UHFFFAOYSA-N.
| Molecular formula | C13H16BClO3 |
|---|---|
| Molecular weight | 266.53 g/mol |
| IUPAC name | 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | DVUIUQDBTIPHFS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)Cl)C=O |
Computed by PubChem (NCBI)