Products 1112209-14-9
CAS 1112209-14-9 appears in our catalog under these names: 4-Chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde 95%, 2-Chloro-5-formylphenylboronic acid pinacol ester, 98%, 98%, 4-Chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 1112209-14-9) is a chemical compound with the molecular formula C13H16BClO3 and a molecular weight of 266.53 g/mol. IUPAC name: 4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: ZTFQWMIMWQKYTL-UHFFFAOYSA-N.
| Molecular formula | C13H16BClO3 |
|---|---|
| Molecular weight | 266.53 g/mol |
| IUPAC name | 4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | ZTFQWMIMWQKYTL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C=O)Cl |
Computed by PubChem (NCBI)