cas: 1451393-13-7 — see every product listed under this CAS number, including other names
(4-Chloro-2-fluoro-3-hydroxyphenyl)boronic acid 97% (CAS 1451393-13-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A810042-250mg |
| cas | 1451393-13-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 426.00 Pln | |
| Ambeed | 1g | 1010.06 Pln | |
| Ambeed | 5g | 2912.44 Pln | |
| Ambeed | 100mg | 270.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A810042 |
(4-chloro-2-fluoro-3-hydroxyphenyl)boronic acid (CAS 1451393-13-7) is a chemical compound with the molecular formula C6H5BClFO3 and a molecular weight of 190.37 g/mol. IUPAC name: (4-chloro-2-fluoro-3-hydroxyphenyl)boronic acid. InChIKey: CYFLEBLGQHFBBB-UHFFFAOYSA-N.
| Molecular formula | C6H5BClFO3 |
|---|---|
| Molecular weight | 190.37 g/mol |
| IUPAC name | (4-chloro-2-fluoro-3-hydroxyphenyl)boronic acid |
| InChIKey | CYFLEBLGQHFBBB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Cl)O)F)(O)O |
Computed by PubChem (NCBI)