CAS 958646-67-8 appears in our catalog under these names: 2-Chloro-6-fluoro-5-hydroxyphenylboronic acid, 95%, (6-Chloro-2-fluoro-3-hydroxyphenyl)boronic acid, 98+%, 2-Chloro-6-fluoro-5-hydroxyphenylboronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
(6-chloro-2-fluoro-3-hydroxyphenyl)boronic acid (CAS 958646-67-8) is a chemical compound with the molecular formula C6H5BClFO3 and a molecular weight of 190.37 g/mol. IUPAC name: (6-chloro-2-fluoro-3-hydroxyphenyl)boronic acid. InChIKey: VHBSCHINLGAFRL-UHFFFAOYSA-N.
| Molecular formula | C6H5BClFO3 |
|---|---|
| Molecular weight | 190.37 g/mol |
| IUPAC name | (6-chloro-2-fluoro-3-hydroxyphenyl)boronic acid |
| InChIKey | VHBSCHINLGAFRL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)O)Cl)(O)O |
Computed by PubChem (NCBI)