CAS 2121512-43-2 is the registry number for 5-Chloro-2-fluoro-4-hydroxyphenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
(5-chloro-2-fluoro-4-hydroxyphenyl)boronic acid (CAS 2121512-43-2) is a chemical compound with the molecular formula C6H5BClFO3 and a molecular weight of 190.37 g/mol. IUPAC name: (5-chloro-2-fluoro-4-hydroxyphenyl)boronic acid. InChIKey: ZLVSTJSQXLBEHB-UHFFFAOYSA-N.
| Molecular formula | C6H5BClFO3 |
|---|---|
| Molecular weight | 190.37 g/mol |
| IUPAC name | (5-chloro-2-fluoro-4-hydroxyphenyl)boronic acid |
| InChIKey | ZLVSTJSQXLBEHB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)O)Cl)(O)O |
Computed by PubChem (NCBI)