Products 2121512-43-2

CAS 2121512-43-2 is the registry number for 5-Chloro-2-fluoro-4-hydroxyphenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(5-chloro-2-fluoro-4-hydroxyphenyl)boronic acid (CAS 2121512-43-2) is a chemical compound with the molecular formula C6H5BClFO3 and a molecular weight of 190.37 g/mol. IUPAC name: (5-chloro-2-fluoro-4-hydroxyphenyl)boronic acid. InChIKey: ZLVSTJSQXLBEHB-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5BClFO3
Molecular weight190.37 g/mol
IUPAC name(5-chloro-2-fluoro-4-hydroxyphenyl)boronic acid
InChIKeyZLVSTJSQXLBEHB-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1F)O)Cl)(O)O

Computed by PubChem (NCBI)