(4-Chloro-3-cyclopropylphenyl)boronic acid, 98%
cas: 1548739-71-4 — see every product listed under this CAS number, including other names
(4-Chloro-3-cyclopropylphenyl)boronic acid, 98% (CAS 1548739-71-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A667636-250mg |
| cas | 1548739-71-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1015.62 Pln | |
| Ambeed | 1g | 2901.31 Pln | |
| Chemat | 50mg | 222.80 Pln | |
| Chemat | 100mg | 376.40 Pln | |
| Chemat | 250mg | 789.20 Pln | |
| Chemat | 1g | 2253.20 Pln | |
| BLDpharm | 50mg | 303.25 Pln | |
| BLDpharm | 100mg | 486.52 Pln | |
| BLDpharm | 250mg | 1091.86 Pln | |
| BLDpharm | 1g | 3124.48 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(4-chloro-3-cyclopropylphenyl)boronic acid (CAS 1548739-71-4) is a chemical compound with the molecular formula C9H10BClO2 and a molecular weight of 196.44 g/mol. IUPAC name: (4-chloro-3-cyclopropylphenyl)boronic acid. InChIKey: XTXQJDYURKNSTR-UHFFFAOYSA-N.
| Molecular formula | C9H10BClO2 |
|---|---|
| Molecular weight | 196.44 g/mol |
| IUPAC name | (4-chloro-3-cyclopropylphenyl)boronic acid |
| InChIKey | XTXQJDYURKNSTR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)C2CC2)(O)O |
Computed by PubChem (NCBI)