Products 1548739-71-4
CAS 1548739-71-4 appears in our catalog under these names: (4–chloro–3–cyclopropylphenyl)boronic acid, 4-CHLORO-3-CYCLOPROPYLPHENYLBORONIC ACID, 98%, (4-Chloro-3-cyclopropylphenyl)boronic acid 98%, (4-Chloro-3-cyclopropylphenyl)boronic acid, 98%, 98%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
(4-chloro-3-cyclopropylphenyl)boronic acid (CAS 1548739-71-4) is a chemical compound with the molecular formula C9H10BClO2 and a molecular weight of 196.44 g/mol. IUPAC name: (4-chloro-3-cyclopropylphenyl)boronic acid. InChIKey: XTXQJDYURKNSTR-UHFFFAOYSA-N.
| Molecular formula | C9H10BClO2 |
|---|---|
| Molecular weight | 196.44 g/mol |
| IUPAC name | (4-chloro-3-cyclopropylphenyl)boronic acid |
| InChIKey | XTXQJDYURKNSTR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)C2CC2)(O)O |
Computed by PubChem (NCBI)