CAS 373384-13-5 appears in our catalog under these names: 2-(4-Chlorophenyl)-1,3,2-dioxaborinane 98%, 2-(4-Chlorophenyl)-1,3,2-dioxaborinane, 98%, 98%, 2-(4-Chlorophenyl)-1,3,2-dioxaborinane, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
2-(4-chlorophenyl)-1,3,2-dioxaborinane (CAS 373384-13-5) is a chemical compound with the molecular formula C9H10BClO2 and a molecular weight of 196.44 g/mol. IUPAC name: 2-(4-chlorophenyl)-1,3,2-dioxaborinane. InChIKey: QLTAXEYAYHGYFK-UHFFFAOYSA-N.
| Molecular formula | C9H10BClO2 |
|---|---|
| Molecular weight | 196.44 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1,3,2-dioxaborinane |
| InChIKey | QLTAXEYAYHGYFK-UHFFFAOYSA-N |
| SMILES | B1(OCCCO1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)