cas: 27652-89-7 — see every product listed under this CAS number, including other names
(4-Chlorophenyl)(pyridin-2-yl)methanol, 98% (CAS 27652-89-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F238887-10G |
| cas | 27652-89-7 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 174.96 Pln | |
| Fluorochem | 25g | 310.33 Pln | |
| Fluorochem | 100g | 706.02 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(4-chlorophenyl)-pyridin-2-ylmethanol (CAS 27652-89-7) is a chemical compound with the molecular formula C12H10ClNO and a molecular weight of 219.66 g/mol. IUPAC name: (4-chlorophenyl)-pyridin-2-ylmethanol. InChIKey: ZFUPOFQRQNJDNS-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | (4-chlorophenyl)-pyridin-2-ylmethanol |
| InChIKey | ZFUPOFQRQNJDNS-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(C2=CC=C(C=C2)Cl)O |
Computed by PubChem (NCBI)